C16H22O2 — CID 134955376
(1R,2R,3S,6S,8S,9R)-6,8-bis(ethenyl)-2,3-diethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one (PubChem CID 134955376) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (1R,2R,3S,6S,8S,9R)-6,8-bis(ethenyl)-2,3-diethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one.
| Compound Name | (1R,2R,3S,6S,8S,9R)-6,8-bis(ethenyl)-2,3-diethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
|---|---|
| PubChem CID | 134955376 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (1R,2R,3S,6S,8S,9R)-6,8-bis(ethenyl)-2,3-diethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-one |
| SMILES | C=C[C@@H]1C[C@@]2(C=C)OC(=O)[C@@]3(CC)[C@H](CC)[C@@H]1[C@H]32 |
| InChI | InChI=1S/C16H22O2/c1-5-10-9-15(7-3)13-12(10)11(6-2)16(13,8-4)14(17)18-15/h5,7,10-13H,1,3,6,8-9H2,2,4H3/t10-,11-,12-,13+,15-,16+/m1/s1 |
| InChIKey | HMWYXIQADDUUFA-DEEDKQTDSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|