C16H17F3O4 — CID 134955442
dimethyl 2-methyl-2-[(E,1S)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate (PubChem CID 134955442) has the molecular formula C16H17F3O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is dimethyl 2-methyl-2-[(E,1S)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate.
| Compound Name | dimethyl 2-methyl-2-[(E,1S)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate |
|---|---|
| PubChem CID | 134955442 |
| Molecular Formula | C16H17F3O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | dimethyl 2-methyl-2-[(E,1S)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate |
| SMILES | COC(=O)C(C)(C(=O)OC)[C@@H](/C=C/C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H17F3O4/c1-15(13(20)22-2,14(21)23-3)12(9-10-16(17,18)19)11-7-5-4-6-8-11/h4-10,12H,1-3H3/b10-9+/t12-/m0/s1 |
| InChIKey | GVBOOHUJPMBUST-VMPCVLLUSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|