C24H25F3O4 — CID 134955444
diethyl 2-benzyl-2-[(E,1S)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate (PubChem CID 134955444) has the molecular formula C24H25F3O4 and a molecular weight of 434.45 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[(E,1S)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[(E,1S)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate |
|---|---|
| PubChem CID | 134955444 |
| Molecular Formula | C24H25F3O4 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | diethyl 2-benzyl-2-[(E,1S)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(C(=O)OCC)[C@@H](/C=C/C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C24H25F3O4/c1-3-30-21(28)23(22(29)31-4-2,17-18-11-7-5-8-12-18)20(15-16-24(25,26)27)19-13-9-6-10-14-19/h5-16,20H,3-4,17H2,1-2H3/b16-15+/t20-/m0/s1 |
| InChIKey | KTHXNVRTGXYAPR-APHAIJBRSA-N |
| XLogP | 5.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|