C27H23F3O4 — CID 134955446
dibenzyl 2-[(E,1R)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate (PubChem CID 134955446) has the molecular formula C27H23F3O4 and a molecular weight of 468.47 g/mol. Its IUPAC name is dibenzyl 2-[(E,1R)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate.
| Compound Name | dibenzyl 2-[(E,1R)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate |
|---|---|
| PubChem CID | 134955446 |
| Molecular Formula | C27H23F3O4 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | dibenzyl 2-[(E,1R)-4,4,4-trifluoro-1-phenylbut-2-enyl]propanedioate |
| SMILES | O=C(OCc1ccccc1)C(C(=O)OCc1ccccc1)[C@@H](/C=C/C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C27H23F3O4/c28-27(29,30)17-16-23(22-14-8-3-9-15-22)24(25(31)33-18-20-10-4-1-5-11-20)26(32)34-19-21-12-6-2-7-13-21/h1-17,23-24H,18-19H2/b17-16+/t23-/m0/s1 |
| InChIKey | KINPZFLYNKVXCO-OFYULWLWSA-N |
| XLogP | 5.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|