C21H21F3O4 — CID 134955447
diethyl 2-[(E,1R)-4,4,4-trifluoro-1-naphthalen-2-ylbut-2-enyl]propanedioate (PubChem CID 134955447) has the molecular formula C21H21F3O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is diethyl 2-[(E,1R)-4,4,4-trifluoro-1-naphthalen-2-ylbut-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E,1R)-4,4,4-trifluoro-1-naphthalen-2-ylbut-2-enyl]propanedioate |
|---|---|
| PubChem CID | 134955447 |
| Molecular Formula | C21H21F3O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | diethyl 2-[(E,1R)-4,4,4-trifluoro-1-naphthalen-2-ylbut-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](/C=C/C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H21F3O4/c1-3-27-19(25)18(20(26)28-4-2)17(11-12-21(22,23)24)16-10-9-14-7-5-6-8-15(14)13-16/h5-13,17-18H,3-4H2,1-2H3/b12-11+/t17-/m0/s1 |
| InChIKey | SOASUWPSFQEZAV-FLVLSHQESA-N |
| XLogP | 4.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|