C34H25F6N2P — CID 134955581
1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1S)-1-(2-diphenylphosphanylphenyl)ethyl]-1-pyridin-2-ylmethanimine (PubChem CID 134955581) has the molecular formula C34H25F6N2P and a molecular weight of 606.55 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1S)-1-(2-diphenylphosphanylphenyl)ethyl]-1-pyridin-2-ylmethanimine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1S)-1-(2-diphenylphosphanylphenyl)ethyl]-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 134955581 |
| Molecular Formula | C34H25F6N2P |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-[(1S)-1-(2-diphenylphosphanylphenyl)ethyl]-1-pyridin-2-ylmethanimine |
| SMILES | C[C@H](/N=C(/c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccn1)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H25F6N2P/c1-23(29-16-8-9-18-31(29)43(27-12-4-2-5-13-27)28-14-6-3-7-15-28)42-32(30-17-10-11-19-41-30)24-20-25(33(35,36)37)22-26(21-24)34(38,39)40/h2-23H,1H3/b42-32-/t23-/m0/s1 |
| InChIKey | NJKKJVYPZXFMGP-ZVLZQNKGSA-N |
| XLogP | 8.48 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|