C24H25FN2O4 — CID 134955726
methyl (1S,3R,3aS,6aR)-5-(2-tert-butylphenyl)-1-(2-fluorophenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 134955726) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-5-(2-tert-butylphenyl)-1-(2-fluorophenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,6aR)-5-(2-tert-butylphenyl)-1-(2-fluorophenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134955726 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-5-(2-tert-butylphenyl)-1-(2-fluorophenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1N[C@H](c2ccccc2F)[C@@H]2C(=O)N(c3ccccc3C(C)(C)C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C24H25FN2O4/c1-24(2,3)14-10-6-8-12-16(14)27-21(28)17-18(22(27)29)20(23(30)31-4)26-19(17)13-9-5-7-11-15(13)25/h5-12,17-20,26H,1-4H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | PLEHCNKERVOERQ-IYWMVGAKSA-N |
| XLogP | 3.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|