C13H9ClF4N2 — CID 134955798
8-(4-chlorophenyl)-5,5,6,6-tetrafluoro-7,8-dihydroimidazo[1,2-a]pyridine (PubChem CID 134955798) has the molecular formula C13H9ClF4N2 and a molecular weight of 304.67 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-5,5,6,6-tetrafluoro-7,8-dihydroimidazo[1,2-a]pyridine.
| Compound Name | 8-(4-chlorophenyl)-5,5,6,6-tetrafluoro-7,8-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 134955798 |
| Molecular Formula | C13H9ClF4N2 |
| Molecular Weight | 304.67 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 8-(4-chlorophenyl)-5,5,6,6-tetrafluoro-7,8-dihydroimidazo[1,2-a]pyridine |
| SMILES | FC1(F)CC(c2ccc(Cl)cc2)c2nccn2C1(F)F |
| InChI | InChI=1S/C13H9ClF4N2/c14-9-3-1-8(2-4-9)10-7-12(15,16)13(17,18)20-6-5-19-11(10)20/h1-6,10H,7H2 |
| InChIKey | CWAMNTWPJWQJNK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|