C18H18ClFO3 — CID 134955879
ethyl (2R,3S)-3-(4-chlorophenyl)-2-(4-fluorophenyl)-2-hydroxybutanoate (PubChem CID 134955879) has the molecular formula C18H18ClFO3 and a molecular weight of 336.79 g/mol. Its IUPAC name is ethyl (2R,3S)-3-(4-chlorophenyl)-2-(4-fluorophenyl)-2-hydroxybutanoate.
| Compound Name | ethyl (2R,3S)-3-(4-chlorophenyl)-2-(4-fluorophenyl)-2-hydroxybutanoate |
|---|---|
| PubChem CID | 134955879 |
| Molecular Formula | C18H18ClFO3 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | ethyl (2R,3S)-3-(4-chlorophenyl)-2-(4-fluorophenyl)-2-hydroxybutanoate |
| SMILES | CCOC(=O)[C@](O)(c1ccc(F)cc1)[C@@H](C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClFO3/c1-3-23-17(21)18(22,14-6-10-16(20)11-7-14)12(2)13-4-8-15(19)9-5-13/h4-12,22H,3H2,1-2H3/t12-,18+/m0/s1 |
| InChIKey | XKCLXHQICBBAHS-KPZWWZAWSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |