C12H21NO3S — CID 134955880
(NE,S)-N-[[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 134955880) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is (NE,S)-N-[[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134955880 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (NE,S)-N-[[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1/C=N/[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C12H21NO3S/c1-7-9-10(16-12(5,6)15-9)8-13-17(14)11(2,3)4/h7-10H,1H2,2-6H3/b13-8+/t9-,10+,17+/m1/s1 |
| InChIKey | ZVJMSYBFFFZPRJ-YXYRQGOBSA-N |
| XLogP | 2.23 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|