C22H16N2O4S — CID 134956125
(2'S,3S,4'R)-4'-hydroxy-2'-(4-nitrophenyl)spiro[1H-indole-3,3'-2,4-dihydrothiochromene]-2-one (PubChem CID 134956125) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is (2'S,3S,4'R)-4'-hydroxy-2'-(4-nitrophenyl)spiro[1H-indole-3,3'-2,4-dihydrothiochromene]-2-one.
| Compound Name | (2'S,3S,4'R)-4'-hydroxy-2'-(4-nitrophenyl)spiro[1H-indole-3,3'-2,4-dihydrothiochromene]-2-one |
|---|---|
| PubChem CID | 134956125 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (2'S,3S,4'R)-4'-hydroxy-2'-(4-nitrophenyl)spiro[1H-indole-3,3'-2,4-dihydrothiochromene]-2-one |
| SMILES | O=C1Nc2ccccc2[C@]12[C@@H](O)c1ccccc1S[C@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H16N2O4S/c25-19-15-5-1-4-8-18(15)29-20(13-9-11-14(12-10-13)24(27)28)22(19)16-6-2-3-7-17(16)23-21(22)26/h1-12,19-20,25H,(H,23,26)/t19-,20-,22+/m0/s1 |
| InChIKey | OXISJKZMZPORKJ-JAXLGGSGSA-N |
| XLogP | 4.37 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|