C10H6N6S — CID 13495619
2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),5,7,9,12,14-hexaene-3-thione (PubChem CID 13495619) has the molecular formula C10H6N6S and a molecular weight of 242.27 g/mol. Its IUPAC name is 2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),5,7,9,12,14-hexaene-3-thione.
| Compound Name | 2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),5,7,9,12,14-hexaene-3-thione |
|---|---|
| PubChem CID | 13495619 |
| Molecular Formula | C10H6N6S |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),5,7,9,12,14-hexaene-3-thione |
| SMILES | S=c1[nH]nc2c3nncn3c3ccccc3n12 |
| InChI | InChI=1S/C10H6N6S/c17-10-14-13-9-8-12-11-5-15(8)6-3-1-2-4-7(6)16(9)10/h1-5H,(H,14,17) |
| InChIKey | XDTQJDBSBWYUHG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|