About 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile
3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile (PubChem CID 134956291) has the molecular formula C18H13N3O3
and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile |
| PubChem CID | 134956291 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile |
| SMILES | N#CCCn1nc(C(=O)c2ccccc2)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H13N3O3/c19-7-4-8-21-14-10-16-15(23-11-24-16)9-13(14)17(20-21)18(22)12-5-2-1-3-6-12/h1-3,5-6,9-10H,4,8,11H2 |
| InChIKey | WIZWCPSAYGSFLL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile?
The IUPAC name of 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile (CID 134956291) is 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile.
What is the SMILES notation for 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile?
The canonical SMILES for 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile is N#CCCn1nc(C(=O)c2ccccc2)c2cc3c(cc21)OCO3.
What is the InChIKey of 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile?
The InChIKey is WIZWCPSAYGSFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O3/c19-7-4-8-21-14-10-16-15(23-11-24-16)9-13(14)17(20-21)18(22)12-5-2-1-3-6-12/h1-3,5-6,9-10H,4,8,11H2.
What are the key properties of 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile?
3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile has a molecular weight of 319.32 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-benzoyl-[1,3]dioxolo[4,5-f]indazol-1-yl)propanenitrile is sourced from PubChem (CID 134956291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).