C30H28F3NO — CID 134956322
(1S,2S)-2-(dibenzylamino)-3-phenyl-1-[3-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 134956322) has the molecular formula C30H28F3NO and a molecular weight of 475.55 g/mol. Its IUPAC name is (1S,2S)-2-(dibenzylamino)-3-phenyl-1-[3-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | (1S,2S)-2-(dibenzylamino)-3-phenyl-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 134956322 |
| Molecular Formula | C30H28F3NO |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (1S,2S)-2-(dibenzylamino)-3-phenyl-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | O[C@@H](c1cccc(C(F)(F)F)c1)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H28F3NO/c31-30(32,33)27-18-10-17-26(20-27)29(35)28(19-23-11-4-1-5-12-23)34(21-24-13-6-2-7-14-24)22-25-15-8-3-9-16-25/h1-18,20,28-29,35H,19,21-22H2/t28-,29-/m0/s1 |
| InChIKey | VRERMJVETHQXRH-VMPREFPWSA-N |
| XLogP | 7.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |