About tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate
tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate (PubChem CID 134956334) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate |
| PubChem CID | 134956334 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](c2ccco2)[C@@]12Cc1ccccc1C2=O |
| InChI | InChI=1S/C19H19NO4/c1-18(2,3)24-17(22)20-15(14-9-6-10-23-14)19(20)11-12-7-4-5-8-13(12)16(19)21/h4-10,15H,11H2,1-3H3/t15-,19+,20?/m0/s1 |
| InChIKey | SCTUSORPHCNODJ-SXBLTQOBSA-N |
| XLogP | 3.75 |
| TPSA | 59.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate?
The IUPAC name of tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate (CID 134956334) is tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate.
What is the SMILES notation for tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate?
The canonical SMILES for tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate is CC(C)(C)OC(=O)N1[C@@H](c2ccco2)[C@@]12Cc1ccccc1C2=O.
What is the InChIKey of tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate?
The InChIKey is SCTUSORPHCNODJ-SXBLTQOBSA-N. The full InChI is InChI=1S/C19H19NO4/c1-18(2,3)24-17(22)20-15(14-9-6-10-23-14)19(20)11-12-7-4-5-8-13(12)16(19)21/h4-10,15H,11H2,1-3H3/t15-,19+,20?/m0/s1.
What are the key properties of tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate?
tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate has a molecular weight of 325.36 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,3'R)-3'-(furan-2-yl)-3-oxospiro[1H-indene-2,2'-aziridine]-1'-carboxylate is sourced from PubChem (CID 134956334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).