C25H27NO3 — CID 134956352
tert-butyl (2R,3S)-2-hydroxy-2,4-diphenyl-3-pyridin-3-ylbutanoate (PubChem CID 134956352) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-hydroxy-2,4-diphenyl-3-pyridin-3-ylbutanoate.
| Compound Name | tert-butyl (2R,3S)-2-hydroxy-2,4-diphenyl-3-pyridin-3-ylbutanoate |
|---|---|
| PubChem CID | 134956352 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl (2R,3S)-2-hydroxy-2,4-diphenyl-3-pyridin-3-ylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@](O)(c1ccccc1)[C@@H](Cc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C25H27NO3/c1-24(2,3)29-23(27)25(28,21-14-8-5-9-15-21)22(20-13-10-16-26-18-20)17-19-11-6-4-7-12-19/h4-16,18,22,28H,17H2,1-3H3/t22-,25-/m0/s1 |
| InChIKey | GXRVICYMGFWELH-DHLKQENFSA-N |
| XLogP | 4.64 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |