C20H21NO3 — CID 134956368
(1S,2R,6S,7R,8E)-4-benzyl-8-butylidene-4-azatricyclo[5.3.0.02,6]decane-3,5,9-trione (PubChem CID 134956368) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (1S,2R,6S,7R,8E)-4-benzyl-8-butylidene-4-azatricyclo[5.3.0.02,6]decane-3,5,9-trione.
| Compound Name | (1S,2R,6S,7R,8E)-4-benzyl-8-butylidene-4-azatricyclo[5.3.0.02,6]decane-3,5,9-trione |
|---|---|
| PubChem CID | 134956368 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (1S,2R,6S,7R,8E)-4-benzyl-8-butylidene-4-azatricyclo[5.3.0.02,6]decane-3,5,9-trione |
| SMILES | CCC/C=C1/C(=O)C[C@@H]2[C@H]3C(=O)N(Cc4ccccc4)C(=O)[C@H]3[C@H]12 |
| InChI | InChI=1S/C20H21NO3/c1-2-3-9-13-15(22)10-14-16(13)18-17(14)19(23)21(20(18)24)11-12-7-5-4-6-8-12/h4-9,14,16-18H,2-3,10-11H2,1H3/b13-9-/t14-,16+,17+,18-/m0/s1 |
| InChIKey | GSOQMNSARMCKRO-HZRGRIPWSA-N |
| XLogP | 2.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|