C18H27F3O3S — CID 134956447
[(3R,6S)-6-(2,4-dimethylpent-4-en-2-yl)-3-methyl-2-prop-2-enylcyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 134956447) has the molecular formula C18H27F3O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is [(3R,6S)-6-(2,4-dimethylpent-4-en-2-yl)-3-methyl-2-prop-2-enylcyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,6S)-6-(2,4-dimethylpent-4-en-2-yl)-3-methyl-2-prop-2-enylcyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134956447 |
| Molecular Formula | C18H27F3O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [(3R,6S)-6-(2,4-dimethylpent-4-en-2-yl)-3-methyl-2-prop-2-enylcyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | C=CCC1=C(OS(=O)(=O)C(F)(F)F)[C@H](C(C)(C)CC(=C)C)CC[C@H]1C |
| InChI | InChI=1S/C18H27F3O3S/c1-7-8-14-13(4)9-10-15(17(5,6)11-12(2)3)16(14)24-25(22,23)18(19,20)21/h7,13,15H,1-2,8-11H2,3-6H3/t13-,15-/m1/s1 |
| InChIKey | GUHQNGAIUVWAPR-UKRRQHHQSA-N |
| XLogP | 5.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|