C22H29NO2 — CID 134956473
(2R)-N-tert-butyl-2-[(E)-2-cyclohexylethenyl]-3-oxo-1H-indene-2-carboxamide (PubChem CID 134956473) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-[(E)-2-cyclohexylethenyl]-3-oxo-1H-indene-2-carboxamide.
| Compound Name | (2R)-N-tert-butyl-2-[(E)-2-cyclohexylethenyl]-3-oxo-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 134956473 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (2R)-N-tert-butyl-2-[(E)-2-cyclohexylethenyl]-3-oxo-1H-indene-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@]1(/C=C/C2CCCCC2)Cc2ccccc2C1=O |
| InChI | InChI=1S/C22H29NO2/c1-21(2,3)23-20(25)22(14-13-16-9-5-4-6-10-16)15-17-11-7-8-12-18(17)19(22)24/h7-8,11-14,16H,4-6,9-10,15H2,1-3H3,(H,23,25)/b14-13+/t22-/m0/s1 |
| InChIKey | GRFJBNJPZOQWNU-TWLJRWAQSA-N |
| XLogP | 4.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|