About 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole
4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole (PubChem CID 134956730) has the molecular formula C17H14Cl2FNO2S
and a molecular weight of 386.28 g/mol. Its IUPAC name is 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole |
| PubChem CID | 134956730 |
| Molecular Formula | C17H14Cl2FNO2S |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2C(Cl)=C(Cl)CC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H14Cl2FNO2S/c1-11-2-8-14(9-3-11)24(22,23)21-16(10-15(18)17(21)19)12-4-6-13(20)7-5-12/h2-9,16H,10H2,1H3 |
| InChIKey | UZZSFSKPOQRCNG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole?
The IUPAC name of 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole (CID 134956730) is 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole.
What is the SMILES notation for 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole?
The canonical SMILES for 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole is Cc1ccc(S(=O)(=O)N2C(Cl)=C(Cl)CC2c2ccc(F)cc2)cc1.
What is the InChIKey of 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole?
The InChIKey is UZZSFSKPOQRCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2FNO2S/c1-11-2-8-14(9-3-11)24(22,23)21-16(10-15(18)17(21)19)12-4-6-13(20)7-5-12/h2-9,16H,10H2,1H3.
What are the key properties of 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole?
4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole has a molecular weight of 386.28 g/mol, XLogP of 4.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrole is sourced from PubChem (CID 134956730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).