C19H29NO2 — CID 134956819
tert-butyl N-[(E,3R)-2,2-dimethyl-6-phenylhex-5-en-3-yl]carbamate (PubChem CID 134956819) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is tert-butyl N-[(E,3R)-2,2-dimethyl-6-phenylhex-5-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(E,3R)-2,2-dimethyl-6-phenylhex-5-en-3-yl]carbamate |
|---|---|
| PubChem CID | 134956819 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | tert-butyl N-[(E,3R)-2,2-dimethyl-6-phenylhex-5-en-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C/C=C/c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H29NO2/c1-18(2,3)16(20-17(21)22-19(4,5)6)14-10-13-15-11-8-7-9-12-15/h7-13,16H,14H2,1-6H3,(H,20,21)/b13-10+/t16-/m1/s1 |
| InChIKey | UJFUGNMNAUYIBP-QSOAKEGCSA-N |
| XLogP | 5.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |