C8H9F5O — CID 13495699
1-(1,1,2,2,2-pentafluoroethyl)cyclohex-2-en-1-ol (PubChem CID 13495699) has the molecular formula C8H9F5O and a molecular weight of 216.15 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethyl)cyclohex-2-en-1-ol.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 13495699 |
| Molecular Formula | C8H9F5O |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethyl)cyclohex-2-en-1-ol |
| SMILES | OC1(C(F)(F)C(F)(F)F)C=CCCC1 |
| InChI | InChI=1S/C8H9F5O/c9-7(10,8(11,12)13)6(14)4-2-1-3-5-6/h2,4,14H,1,3,5H2 |
| InChIKey | IDTUHZNRUVESEG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|