C34H64O5Si2 — CID 134956993
(4S,7R,8S,9S,13Z,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-16-ethenyl-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 134956993) has the molecular formula C34H64O5Si2 and a molecular weight of 609.05 g/mol. Its IUPAC name is (4S,7R,8S,9S,13Z,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-16-ethenyl-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13Z,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-16-ethenyl-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 134956993 |
| Molecular Formula | C34H64O5Si2 |
| Molecular Weight | 609.05 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | (4S,7R,8S,9S,13Z,16S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-16-ethenyl-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C=C[C@@H]1C/C=C(/C)CCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C34H64O5Si2/c1-17-27-22-21-24(2)19-18-20-25(3)30(39-41(15,16)33(8,9)10)26(4)31(36)34(11,12)28(23-29(35)37-27)38-40(13,14)32(5,6)7/h17,21,25-28,30H,1,18-20,22-23H2,2-16H3/b24-21-/t25-,26+,27+,28-,30-/m0/s1 |
| InChIKey | HSHZIULXIPVIQF-SNJZPMTFSA-N |
| XLogP | 9.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.05 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|