About (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one
(9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one (PubChem CID 134957085) has the molecular formula C19H28O3
and a molecular weight of 304.43 g/mol. Its IUPAC name is (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one.
Molecular Properties
| Compound Name | (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one |
| PubChem CID | 134957085 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one |
| SMILES | C=C/C(C)=C/CCC(=O)C#CC(OC1CCCCO1)C(C)C |
| InChI | InChI=1S/C19H28O3/c1-5-16(4)9-8-10-17(20)12-13-18(15(2)3)22-19-11-6-7-14-21-19/h5,9,15,18-19H,1,6-8,10-11,14H2,2-4H3/b16-9+ |
| InChIKey | GPFZPBMKQXJEDU-CXUHLZMHSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one?
The IUPAC name of (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one (CID 134957085) is (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one.
What is the SMILES notation for (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one?
The canonical SMILES for (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one is C=C/C(C)=C/CCC(=O)C#CC(OC1CCCCO1)C(C)C.
What is the InChIKey of (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one?
The InChIKey is GPFZPBMKQXJEDU-CXUHLZMHSA-N. The full InChI is InChI=1S/C19H28O3/c1-5-16(4)9-8-10-17(20)12-13-18(15(2)3)22-19-11-6-7-14-21-19/h5,9,15,18-19H,1,6-8,10-11,14H2,2-4H3/b16-9+.
What are the key properties of (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one?
(9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one has a molecular weight of 304.43 g/mol, XLogP of 4.04, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-one is sourced from PubChem (CID 134957085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).