C21H32O5 — CID 134957267
ethyl (2S,6S)-4-(cyclohexylmethoxy)-6-ethenyl-2-(prop-2-enoxymethyl)-3,6-dihydro-2H-pyran-5-carboxylate (PubChem CID 134957267) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is ethyl (2S,6S)-4-(cyclohexylmethoxy)-6-ethenyl-2-(prop-2-enoxymethyl)-3,6-dihydro-2H-pyran-5-carboxylate.
| Compound Name | ethyl (2S,6S)-4-(cyclohexylmethoxy)-6-ethenyl-2-(prop-2-enoxymethyl)-3,6-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 134957267 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | ethyl (2S,6S)-4-(cyclohexylmethoxy)-6-ethenyl-2-(prop-2-enoxymethyl)-3,6-dihydro-2H-pyran-5-carboxylate |
| SMILES | C=CCOC[C@@H]1CC(OCC2CCCCC2)=C(C(=O)OCC)[C@H](C=C)O1 |
| InChI | InChI=1S/C21H32O5/c1-4-12-23-15-17-13-19(25-14-16-10-8-7-9-11-16)20(18(5-2)26-17)21(22)24-6-3/h4-5,16-18H,1-2,6-15H2,3H3/t17-,18-/m0/s1 |
| InChIKey | GXDRHJNCIDURKC-ROUUACIJSA-N |
| XLogP | 3.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|