C21H23NO3 — CID 134957361
2,2,5-trimethyl-6-[(2S)-3-methyl-2-quinolin-3-ylbut-3-enyl]-1,3-dioxin-4-one (PubChem CID 134957361) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2,2,5-trimethyl-6-[(2S)-3-methyl-2-quinolin-3-ylbut-3-enyl]-1,3-dioxin-4-one.
| Compound Name | 2,2,5-trimethyl-6-[(2S)-3-methyl-2-quinolin-3-ylbut-3-enyl]-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 134957361 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2,2,5-trimethyl-6-[(2S)-3-methyl-2-quinolin-3-ylbut-3-enyl]-1,3-dioxin-4-one |
| SMILES | C=C(C)[C@H](CC1=C(C)C(=O)OC(C)(C)O1)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C21H23NO3/c1-13(2)17(11-19-14(3)20(23)25-21(4,5)24-19)16-10-15-8-6-7-9-18(15)22-12-16/h6-10,12,17H,1,11H2,2-5H3/t17-/m0/s1 |
| InChIKey | SZDLWBYUNUUNGY-KRWDZBQOSA-N |
| XLogP | 4.87 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|