C18H25N3O — CID 134957612
(1S,2R)-2-(4-hexyltriazol-1-yl)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 134957612) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is (1S,2R)-2-(4-hexyltriazol-1-yl)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S,2R)-2-(4-hexyltriazol-1-yl)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 134957612 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (1S,2R)-2-(4-hexyltriazol-1-yl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CCCCCCc1cn([C@@H]2CCc3ccccc3[C@@H]2O)nn1 |
| InChI | InChI=1S/C18H25N3O/c1-2-3-4-5-9-15-13-21(20-19-15)17-12-11-14-8-6-7-10-16(14)18(17)22/h6-8,10,13,17-18,22H,2-5,9,11-12H2,1H3/t17-,18+/m1/s1 |
| InChIKey | VIQJVJIIQUDJNZ-MSOLQXFVSA-N |
| XLogP | 3.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|