About CID 134957663
CID 134957663 (PubChem CID 134957663) has the molecular formula C16H14FNO3
and a molecular weight of 287.29 g/mol.
Molecular Properties
| Compound Name | CID 134957663 |
| PubChem CID | 134957663 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@]2(C=CC3(CCCC3=O)O2)c2ccc(F)cc21 |
| InChI | InChI=1S/C16H14FNO3/c1-18-12-9-10(17)4-5-11(12)16(14(18)20)8-7-15(21-16)6-2-3-13(15)19/h4-5,7-9H,2-3,6H2,1H3/t15?,16-/m0/s1 |
| InChIKey | KITXEPUCGJDDGK-LYKKTTPLSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 134957663 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134957663?
The IUPAC name of CID 134957663 (CID 134957663) is not available.
What is the SMILES notation for CID 134957663?
The canonical SMILES for CID 134957663 is CN1C(=O)[C@]2(C=CC3(CCCC3=O)O2)c2ccc(F)cc21.
What is the InChIKey of CID 134957663?
The InChIKey is KITXEPUCGJDDGK-LYKKTTPLSA-N. The full InChI is InChI=1S/C16H14FNO3/c1-18-12-9-10(17)4-5-11(12)16(14(18)20)8-7-15(21-16)6-2-3-13(15)19/h4-5,7-9H,2-3,6H2,1H3/t15?,16-/m0/s1.
What are the key properties of CID 134957663?
CID 134957663 has a molecular weight of 287.29 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134957663 is sourced from PubChem (CID 134957663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).