About 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one
3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one (PubChem CID 134957674) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one |
| PubChem CID | 134957674 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one |
| SMILES | C[C@H]1CCC[C@@H](CC(=O)C(C)(C)C)N1 |
| InChI | InChI=1S/C12H23NO/c1-9-6-5-7-10(13-9)8-11(14)12(2,3)4/h9-10,13H,5-8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | QVILMMPDSGRAQU-UWVGGRQHSA-N |
| XLogP | 2.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one?
The IUPAC name of 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one (CID 134957674) is 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one.
What is the SMILES notation for 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one?
The canonical SMILES for 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one is C[C@H]1CCC[C@@H](CC(=O)C(C)(C)C)N1.
What is the InChIKey of 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one?
The InChIKey is QVILMMPDSGRAQU-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H23NO/c1-9-6-5-7-10(13-9)8-11(14)12(2,3)4/h9-10,13H,5-8H2,1-4H3/t9-,10-/m0/s1.
What are the key properties of 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one?
3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one has a molecular weight of 197.32 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-[(2S,6S)-6-methylpiperidin-2-yl]butan-2-one is sourced from PubChem (CID 134957674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).