C13H13NO — CID 134957787
(2S)-2-(furan-2-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 134957787) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S)-2-(furan-2-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 134957787 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2S)-2-(furan-2-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1coc([C@@H]2CCc3ccccc3N2)c1 |
| InChI | InChI=1S/C13H13NO/c1-2-5-11-10(4-1)7-8-12(14-11)13-6-3-9-15-13/h1-6,9,12,14H,7-8H2/t12-/m0/s1 |
| InChIKey | KPQQMSMNJLGIEM-LBPRGKRZSA-N |
| XLogP | 3.38 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |