C19H27NO7S — CID 134957801
diethyl (3R,5R)-3-methoxy-3-methyl-1-methylsulfonyl-5-phenylpyrrolidine-2,2-dicarboxylate (PubChem CID 134957801) has the molecular formula C19H27NO7S and a molecular weight of 413.49 g/mol. Its IUPAC name is diethyl (3R,5R)-3-methoxy-3-methyl-1-methylsulfonyl-5-phenylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3R,5R)-3-methoxy-3-methyl-1-methylsulfonyl-5-phenylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134957801 |
| Molecular Formula | C19H27NO7S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | diethyl (3R,5R)-3-methoxy-3-methyl-1-methylsulfonyl-5-phenylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N(S(C)(=O)=O)[C@@H](c2ccccc2)C[C@@]1(C)OC |
| InChI | InChI=1S/C19H27NO7S/c1-6-26-16(21)19(17(22)27-7-2)18(3,25-4)13-15(20(19)28(5,23)24)14-11-9-8-10-12-14/h8-12,15H,6-7,13H2,1-5H3/t15-,18-/m1/s1 |
| InChIKey | COSVYSFPUVJEEU-CRAIPNDOSA-N |
| XLogP | 1.66 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|