C19H20ClN — CID 134957836
(2S)-5-chloro-2-phenylspiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 134957836) has the molecular formula C19H20ClN and a molecular weight of 297.83 g/mol. Its IUPAC name is (2S)-5-chloro-2-phenylspiro[1,2-dihydroindole-3,1'-cyclohexane].
| Compound Name | (2S)-5-chloro-2-phenylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 134957836 |
| Molecular Formula | C19H20ClN |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (2S)-5-chloro-2-phenylspiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | Clc1ccc2c(c1)C1(CCCCC1)[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C19H20ClN/c20-15-9-10-17-16(13-15)19(11-5-2-6-12-19)18(21-17)14-7-3-1-4-8-14/h1,3-4,7-10,13,18,21H,2,5-6,11-12H2/t18-/m0/s1 |
| InChIKey | HKSRFWADPNEJIX-SFHVURJKSA-N |
| XLogP | 5.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |