About 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole
1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole (PubChem CID 134957894) has the molecular formula C18H19NO2S2
and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole |
| PubChem CID | 134957894 |
| Molecular Formula | C18H19NO2S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=CC2C/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C18H19NO2S2/c1-15-9-11-18(12-10-15)23(20,21)19-13-3-6-16(19)5-2-7-17-8-4-14-22-17/h2-4,6-12,14,16H,5,13H2,1H3/b7-2+ |
| InChIKey | AMMINQZNCVEYJO-FARCUNLSSA-N |
| XLogP | 4.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole?
The IUPAC name of 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole (CID 134957894) is 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole.
What is the SMILES notation for 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole?
The canonical SMILES for 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole is Cc1ccc(S(=O)(=O)N2CC=CC2C/C=C/c2cccs2)cc1.
What is the InChIKey of 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole?
The InChIKey is AMMINQZNCVEYJO-FARCUNLSSA-N. The full InChI is InChI=1S/C18H19NO2S2/c1-15-9-11-18(12-10-15)23(20,21)19-13-3-6-16(19)5-2-7-17-8-4-14-22-17/h2-4,6-12,14,16H,5,13H2,1H3/b7-2+.
What are the key properties of 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole?
1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole has a molecular weight of 345.49 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)sulfonyl-2-[(E)-3-thiophen-2-ylprop-2-enyl]-2,5-dihydropyrrole is sourced from PubChem (CID 134957894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).