C17H19N3O2 — CID 134957944
(2S,3S,4S)-4-azido-2,4-diphenylpentane-2,3-diol (PubChem CID 134957944) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is (2S,3S,4S)-4-azido-2,4-diphenylpentane-2,3-diol.
| Compound Name | (2S,3S,4S)-4-azido-2,4-diphenylpentane-2,3-diol |
|---|---|
| PubChem CID | 134957944 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (2S,3S,4S)-4-azido-2,4-diphenylpentane-2,3-diol |
| SMILES | C[C@](O)(c1ccccc1)[C@@H](O)[C@@](C)(N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c1-16(19-20-18,13-9-5-3-6-10-13)15(21)17(2,22)14-11-7-4-8-12-14/h3-12,15,21-22H,1-2H3/t15-,16-,17-/m0/s1 |
| InChIKey | JWUZYZZCFXYRSE-ULQDDVLXSA-N |
| XLogP | 3.48 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|