C11H15F9O — CID 134957960
7,7,8,8,9,9,10,10,10-nonafluoro-5-methyldecan-5-ol (PubChem CID 134957960) has the molecular formula C11H15F9O and a molecular weight of 334.22 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,10-nonafluoro-5-methyldecan-5-ol.
| Compound Name | 7,7,8,8,9,9,10,10,10-nonafluoro-5-methyldecan-5-ol |
|---|---|
| PubChem CID | 134957960 |
| Molecular Formula | C11H15F9O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 7,7,8,8,9,9,10,10,10-nonafluoro-5-methyldecan-5-ol |
| SMILES | CCCCC(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F9O/c1-3-4-5-7(2,21)6-8(12,13)9(14,15)10(16,17)11(18,19)20/h21H,3-6H2,1-2H3 |
| InChIKey | USPZBIZZWUVQPW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|