About (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one
(2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one (PubChem CID 134957996) has the molecular formula C22H14FNO
and a molecular weight of 327.36 g/mol. Its IUPAC name is (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one.
Molecular Properties
| Compound Name | (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one |
| PubChem CID | 134957996 |
| Molecular Formula | C22H14FNO |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one |
| SMILES | O=C1c2ccccc2C[C@]12C(c1ccccc1)=Nc1cc(F)ccc12 |
| InChI | InChI=1S/C22H14FNO/c23-16-10-11-18-19(12-16)24-20(14-6-2-1-3-7-14)22(18)13-15-8-4-5-9-17(15)21(22)25/h1-12H,13H2/t22-/m0/s1 |
| InChIKey | SRFZNLFZJULPGC-QFIPXVFZSA-N |
| XLogP | 4.64 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one?
The IUPAC name of (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one (CID 134957996) is (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one.
What is the SMILES notation for (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one?
The canonical SMILES for (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one is O=C1c2ccccc2C[C@]12C(c1ccccc1)=Nc1cc(F)ccc12.
What is the InChIKey of (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one?
The InChIKey is SRFZNLFZJULPGC-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H14FNO/c23-16-10-11-18-19(12-16)24-20(14-6-2-1-3-7-14)22(18)13-15-8-4-5-9-17(15)21(22)25/h1-12H,13H2/t22-/m0/s1.
What are the key properties of (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one?
(2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one has a molecular weight of 327.36 g/mol, XLogP of 4.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6'-fluoro-2'-phenylspiro[3H-indene-2,3'-indole]-1-one is sourced from PubChem (CID 134957996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).