C24H35NO7S — CID 134958008
diethyl (4aR,5R,7aR)-7a-(2-methylpropyl)-6-methylsulfonyl-5-phenyl-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate (PubChem CID 134958008) has the molecular formula C24H35NO7S and a molecular weight of 481.61 g/mol. Its IUPAC name is diethyl (4aR,5R,7aR)-7a-(2-methylpropyl)-6-methylsulfonyl-5-phenyl-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate.
| Compound Name | diethyl (4aR,5R,7aR)-7a-(2-methylpropyl)-6-methylsulfonyl-5-phenyl-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate |
|---|---|
| PubChem CID | 134958008 |
| Molecular Formula | C24H35NO7S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | diethyl (4aR,5R,7aR)-7a-(2-methylpropyl)-6-methylsulfonyl-5-phenyl-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N(S(C)(=O)=O)[C@@H](c2ccccc2)[C@H]2CCCO[C@]21CC(C)C |
| InChI | InChI=1S/C24H35NO7S/c1-6-30-21(26)24(22(27)31-7-2)23(16-17(3)4)19(14-11-15-32-23)20(25(24)33(5,28)29)18-12-9-8-10-13-18/h8-10,12-13,17,19-20H,6-7,11,14-16H2,1-5H3/t19-,20+,23-/m1/s1 |
| InChIKey | YUBWIQSQCJJLOR-ZRCGQRJVSA-N |
| XLogP | 3.08 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|