C20H27NO7S — CID 134958010
diethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate (PubChem CID 134958010) has the molecular formula C20H27NO7S and a molecular weight of 425.50 g/mol. Its IUPAC name is diethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate.
| Compound Name | diethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate |
|---|---|
| PubChem CID | 134958010 |
| Molecular Formula | C20H27NO7S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | diethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H]2OCCC[C@@H]2[C@H](c2ccccc2)N1S(C)(=O)=O |
| InChI | InChI=1S/C20H27NO7S/c1-4-26-18(22)20(19(23)27-5-2)17-15(12-9-13-28-17)16(21(20)29(3,24)25)14-10-7-6-8-11-14/h6-8,10-11,15-17H,4-5,9,12-13H2,1-3H3/t15-,16+,17+/m1/s1 |
| InChIKey | QPFHJTBGRPJYLK-IKGGRYGDSA-N |
| XLogP | 1.66 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|