C26H31NO7S — CID 134958011
diethyl (4aR,5R,7aS)-6-(4-methylphenyl)sulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate (PubChem CID 134958011) has the molecular formula C26H31NO7S and a molecular weight of 501.60 g/mol. Its IUPAC name is diethyl (4aR,5R,7aS)-6-(4-methylphenyl)sulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate.
| Compound Name | diethyl (4aR,5R,7aS)-6-(4-methylphenyl)sulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate |
|---|---|
| PubChem CID | 134958011 |
| Molecular Formula | C26H31NO7S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | diethyl (4aR,5R,7aS)-6-(4-methylphenyl)sulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H]2OCCC[C@@H]2[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H31NO7S/c1-4-32-24(28)26(25(29)33-5-2)23-21(12-9-17-34-23)22(19-10-7-6-8-11-19)27(26)35(30,31)20-15-13-18(3)14-16-20/h6-8,10-11,13-16,21-23H,4-5,9,12,17H2,1-3H3/t21-,22+,23+/m1/s1 |
| InChIKey | IRWFUYQKGMVPSI-VJBWXMMDSA-N |
| XLogP | 3.40 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|