C18H23NO7S — CID 134958012
dimethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate (PubChem CID 134958012) has the molecular formula C18H23NO7S and a molecular weight of 397.45 g/mol. Its IUPAC name is dimethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate.
| Compound Name | dimethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate |
|---|---|
| PubChem CID | 134958012 |
| Molecular Formula | C18H23NO7S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | dimethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@H]2OCCC[C@@H]2[C@H](c2ccccc2)N1S(C)(=O)=O |
| InChI | InChI=1S/C18H23NO7S/c1-24-16(20)18(17(21)25-2)15-13(10-7-11-26-15)14(19(18)27(3,22)23)12-8-5-4-6-9-12/h4-6,8-9,13-15H,7,10-11H2,1-3H3/t13-,14+,15+/m1/s1 |
| InChIKey | HZTYVZVDFNGODA-ILXRZTDVSA-N |
| XLogP | 0.88 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|