C24H29NO7S — CID 134958013
diethyl (3S,5R)-3-methoxy-1-methylsulfonyl-3,5-diphenylpyrrolidine-2,2-dicarboxylate (PubChem CID 134958013) has the molecular formula C24H29NO7S and a molecular weight of 475.56 g/mol. Its IUPAC name is diethyl (3S,5R)-3-methoxy-1-methylsulfonyl-3,5-diphenylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3S,5R)-3-methoxy-1-methylsulfonyl-3,5-diphenylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134958013 |
| Molecular Formula | C24H29NO7S |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | diethyl (3S,5R)-3-methoxy-1-methylsulfonyl-3,5-diphenylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N(S(C)(=O)=O)[C@@H](c2ccccc2)C[C@]1(OC)c1ccccc1 |
| InChI | InChI=1S/C24H29NO7S/c1-5-31-21(26)24(22(27)32-6-2)23(30-3,19-15-11-8-12-16-19)17-20(25(24)33(4,28)29)18-13-9-7-10-14-18/h7-16,20H,5-6,17H2,1-4H3/t20-,23+/m1/s1 |
| InChIKey | SYIVPZQNWVLRKK-OFNKIYASSA-N |
| XLogP | 2.80 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|