C29H47NO8SSi — CID 134958015
diethyl (4aR,5R,7aR)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methylsulfonyl-5-phenyl-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate (PubChem CID 134958015) has the molecular formula C29H47NO8SSi and a molecular weight of 597.85 g/mol. Its IUPAC name is diethyl (4aR,5R,7aR)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methylsulfonyl-5-phenyl-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate.
| Compound Name | diethyl (4aR,5R,7aR)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methylsulfonyl-5-phenyl-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate |
|---|---|
| PubChem CID | 134958015 |
| Molecular Formula | C29H47NO8SSi |
| Molecular Weight | 597.85 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | diethyl (4aR,5R,7aR)-7a-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methylsulfonyl-5-phenyl-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N(S(C)(=O)=O)[C@@H](c2ccccc2)[C@H]2CCCO[C@]21CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H47NO8SSi/c1-9-35-25(31)29(26(32)36-10-2)28(19-15-21-38-40(7,8)27(3,4)5)23(18-14-20-37-28)24(30(29)39(6,33)34)22-16-12-11-13-17-22/h11-13,16-17,23-24H,9-10,14-15,18-21H2,1-8H3/t23-,24+,28-/m1/s1 |
| InChIKey | UYKPKVXEIYDJPO-FMGHJNRGSA-N |
| XLogP | 4.84 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.85 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|