C23H16F20O5S — CID 134958051
ethyl 4-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-propyl-1-(trifluoromethylsulfonyloxy)dec-1-enyl]benzoate (PubChem CID 134958051) has the molecular formula C23H16F20O5S and a molecular weight of 784.40 g/mol. Its IUPAC name is ethyl 4-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-propyl-1-(trifluoromethylsulfonyloxy)dec-1-enyl]benzoate.
| Compound Name | ethyl 4-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-propyl-1-(trifluoromethylsulfonyloxy)dec-1-enyl]benzoate |
|---|---|
| PubChem CID | 134958051 |
| Molecular Formula | C23H16F20O5S |
| Molecular Weight | 784.40 g/mol |
| Exact Mass | 784.04 |
| IUPAC Name | ethyl 4-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-propyl-1-(trifluoromethylsulfonyloxy)dec-1-enyl]benzoate |
| SMILES | CCC/C(=C(\OS(=O)(=O)C(F)(F)F)c1ccc(C(=O)OCC)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H16F20O5S/c1-3-5-12(13(48-49(45,46)23(41,42)43)10-6-8-11(9-7-10)14(44)47-4-2)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)22(38,39)40/h6-9H,3-5H2,1-2H3/b13-12+ |
| InChIKey | NKEDIWOGTCRROR-OUKQBFOZSA-N |
| XLogP | 9.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.40 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|