C24H22F3NO4 — CID 134958309
tert-butyl (1S,9S,10S)-11-oxo-10-[4-(trifluoromethyl)phenyl]-12-oxa-8-azatetracyclo[7.5.0.01,10.02,7]tetradeca-2,4,6-triene-8-carboxylate (PubChem CID 134958309) has the molecular formula C24H22F3NO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is tert-butyl (1S,9S,10S)-11-oxo-10-[4-(trifluoromethyl)phenyl]-12-oxa-8-azatetracyclo[7.5.0.01,10.02,7]tetradeca-2,4,6-triene-8-carboxylate.
| Compound Name | tert-butyl (1S,9S,10S)-11-oxo-10-[4-(trifluoromethyl)phenyl]-12-oxa-8-azatetracyclo[7.5.0.01,10.02,7]tetradeca-2,4,6-triene-8-carboxylate |
|---|---|
| PubChem CID | 134958309 |
| Molecular Formula | C24H22F3NO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | tert-butyl (1S,9S,10S)-11-oxo-10-[4-(trifluoromethyl)phenyl]-12-oxa-8-azatetracyclo[7.5.0.01,10.02,7]tetradeca-2,4,6-triene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2[C@@]23CCOC(=O)[C@]2(c2ccc(C(F)(F)F)cc2)[C@@H]13 |
| InChI | InChI=1S/C24H22F3NO4/c1-21(2,3)32-20(30)28-17-7-5-4-6-16(17)22-12-13-31-19(29)23(22,18(22)28)14-8-10-15(11-9-14)24(25,26)27/h4-11,18H,12-13H2,1-3H3/t18-,22+,23-/m0/s1 |
| InChIKey | MJRVAFLXCBPJFS-NMNUPHIUSA-N |
| XLogP | 4.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |