About CID 134958319
CID 134958319 (PubChem CID 134958319) has the molecular formula C16H24NO2S
and a molecular weight of 294.44 g/mol.
Molecular Properties
| Compound Name | CID 134958319 |
| PubChem CID | 134958319 |
| Molecular Formula | C16H24NO2S |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | — |
| SMILES | CC[C@@H]([CH]N1CCC[C@H]1C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24NO2S/c1-3-15(12-17-11-7-8-14(17)2)13-20(18,19)16-9-5-4-6-10-16/h4-6,9-10,12,14-15H,3,7-8,11,13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | JXYMOZDAVXVVGJ-CABCVRRESA-N |
| XLogP | 3.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 134958319 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134958319?
The IUPAC name of CID 134958319 (CID 134958319) is not available.
What is the SMILES notation for CID 134958319?
The canonical SMILES for CID 134958319 is CC[C@@H]([CH]N1CCC[C@H]1C)CS(=O)(=O)c1ccccc1.
What is the InChIKey of CID 134958319?
The InChIKey is JXYMOZDAVXVVGJ-CABCVRRESA-N. The full InChI is InChI=1S/C16H24NO2S/c1-3-15(12-17-11-7-8-14(17)2)13-20(18,19)16-9-5-4-6-10-16/h4-6,9-10,12,14-15H,3,7-8,11,13H2,1-2H3/t14-,15+/m1/s1.
What are the key properties of CID 134958319?
CID 134958319 has a molecular weight of 294.44 g/mol, XLogP of 3.13, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134958319 is sourced from PubChem (CID 134958319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).