About 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile
2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile (PubChem CID 134958599) has the molecular formula C18H15BrN2S
and a molecular weight of 371.30 g/mol. Its IUPAC name is 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile |
| PubChem CID | 134958599 |
| Molecular Formula | C18H15BrN2S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile |
| SMILES | C/C(=C\c1cccs1)C[C@H](c1ccccc1Br)C(C#N)C#N |
| InChI | InChI=1S/C18H15BrN2S/c1-13(9-15-5-4-8-22-15)10-17(14(11-20)12-21)16-6-2-3-7-18(16)19/h2-9,14,17H,10H2,1H3/b13-9+/t17-/m0/s1 |
| InChIKey | DJGDLVYQPMIHAJ-VEMDQMBVSA-N |
| XLogP | 5.75 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile?
The IUPAC name of 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile (CID 134958599) is 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile.
What is the SMILES notation for 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile?
The canonical SMILES for 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile is C/C(=C\c1cccs1)C[C@H](c1ccccc1Br)C(C#N)C#N.
What is the InChIKey of 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile?
The InChIKey is DJGDLVYQPMIHAJ-VEMDQMBVSA-N. The full InChI is InChI=1S/C18H15BrN2S/c1-13(9-15-5-4-8-22-15)10-17(14(11-20)12-21)16-6-2-3-7-18(16)19/h2-9,14,17H,10H2,1H3/b13-9+/t17-/m0/s1.
What are the key properties of 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile?
2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile has a molecular weight of 371.30 g/mol, XLogP of 5.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E,1S)-1-(2-bromophenyl)-3-methyl-4-thiophen-2-ylbut-3-enyl]propanedinitrile is sourced from PubChem (CID 134958599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).