About (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane]
(2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane] (PubChem CID 134958755) has the molecular formula C18H19N
and a molecular weight of 249.36 g/mol. Its IUPAC name is (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane].
Molecular Properties
| Compound Name | (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane] |
| PubChem CID | 134958755 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane] |
| SMILES | c1ccc([C@@H]2Nc3ccccc3C23CCCC3)cc1 |
| InChI | InChI=1S/C18H19N/c1-2-8-14(9-3-1)17-18(12-6-7-13-18)15-10-4-5-11-16(15)19-17/h1-5,8-11,17,19H,6-7,12-13H2/t17-/m0/s1 |
| InChIKey | DXDLIJVJEPUXSZ-KRWDZBQOSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane]?
The IUPAC name of (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane] (CID 134958755) is (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane].
What is the SMILES notation for (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane]?
The canonical SMILES for (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane] is c1ccc([C@@H]2Nc3ccccc3C23CCCC3)cc1.
What is the InChIKey of (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane]?
The InChIKey is DXDLIJVJEPUXSZ-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H19N/c1-2-8-14(9-3-1)17-18(12-6-7-13-18)15-10-4-5-11-16(15)19-17/h1-5,8-11,17,19H,6-7,12-13H2/t17-/m0/s1.
What are the key properties of (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane]?
(2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane] has a molecular weight of 249.36 g/mol, XLogP of 4.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-phenylspiro[1,2-dihydroindole-3,1'-cyclopentane] is sourced from PubChem (CID 134958755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).