About [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium)
[(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium) (PubChem CID 134959087) has the molecular formula C6H13NO4Rh2S
and a molecular weight of 401.05 g/mol. Its IUPAC name is [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium).
Molecular Properties
| Compound Name | [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium) |
| PubChem CID | 134959087 |
| Molecular Formula | C6H13NO4Rh2S |
| Molecular Weight | 401.05 g/mol |
| Exact Mass | 400.87 |
| IUPAC Name | [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium) |
| SMILES | CS(=O)(=O)N1CCC[C@H]1C(O)O.[Rh].[Rh] |
| InChI | InChI=1S/C6H13NO4S.2Rh/c1-12(10,11)7-4-2-3-5(7)6(8)9;;/h5-6,8-9H,2-4H2,1H3;;/t5-;;/m0../s1 |
| InChIKey | AUXQAFKMIYPNTP-XRIGFGBMSA-N |
| XLogP | -1.28 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.05 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium)?
The IUPAC name of [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium) (CID 134959087) is [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium).
What is the SMILES notation for [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium)?
The canonical SMILES for [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium) is CS(=O)(=O)N1CCC[C@H]1C(O)O.[Rh].[Rh].
What is the InChIKey of [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium)?
The InChIKey is AUXQAFKMIYPNTP-XRIGFGBMSA-N. The full InChI is InChI=1S/C6H13NO4S.2Rh/c1-12(10,11)7-4-2-3-5(7)6(8)9;;/h5-6,8-9H,2-4H2,1H3;;/t5-;;/m0../s1.
What are the key properties of [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium)?
[(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium) has a molecular weight of 401.05 g/mol, XLogP of -1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-methylsulfonylpyrrolidin-2-yl]methanediol;bis(rhodium) is sourced from PubChem (CID 134959087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).