About lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate
lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate (PubChem CID 134959170) has the molecular formula C20H23ClLiNO2
and a molecular weight of 351.80 g/mol. Its IUPAC name is lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate.
Molecular Properties
| Compound Name | lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate |
| PubChem CID | 134959170 |
| Molecular Formula | C20H23ClLiNO2 |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N([CH-]c1ccccc1)CCc1ccccc1Cl.[Li+] |
| InChI | InChI=1S/C20H23ClNO2.Li/c1-20(2,3)24-19(23)22(15-16-9-5-4-6-10-16)14-13-17-11-7-8-12-18(17)21;/h4-12,15H,13-14H2,1-3H3;/q-1;+1 |
| InChIKey | BHDQPLTWDQGUCU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate?
The IUPAC name of lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate (CID 134959170) is lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate.
What is the SMILES notation for lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate?
The canonical SMILES for lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate is CC(C)(C)OC(=O)N([CH-]c1ccccc1)CCc1ccccc1Cl.[Li+].
What is the InChIKey of lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate?
The InChIKey is BHDQPLTWDQGUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23ClNO2.Li/c1-20(2,3)24-19(23)22(15-16-9-5-4-6-10-16)14-13-17-11-7-8-12-18(17)21;/h4-12,15H,13-14H2,1-3H3;/q-1;+1.
What are the key properties of lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate?
lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate has a molecular weight of 351.80 g/mol, XLogP of 2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium tert-butyl N-[2-(2-chlorophenyl)ethyl]-N-(phenylmethyl)carbamate is sourced from PubChem (CID 134959170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).