About 2,4,6-tribromopyridine
2,4,6-tribromopyridine (PubChem CID 13495919) has the molecular formula C5H2Br3N
and a molecular weight of 315.79 g/mol. Its IUPAC name is 2,4,6-tribromopyridine.
Molecular Properties
| Compound Name | 2,4,6-tribromopyridine |
| PubChem CID | 13495919 |
| Molecular Formula | C5H2Br3N |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 312.77 |
| IUPAC Name | 2,4,6-tribromopyridine |
| SMILES | Brc1cc(Br)nc(Br)c1 |
| InChI | InChI=1S/C5H2Br3N/c6-3-1-4(7)9-5(8)2-3/h1-2H |
| InChIKey | WALXYTCBNHJWER-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-tribromopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-tribromopyridine?
The IUPAC name of 2,4,6-tribromopyridine (CID 13495919) is 2,4,6-tribromopyridine.
What is the SMILES notation for 2,4,6-tribromopyridine?
The canonical SMILES for 2,4,6-tribromopyridine is Brc1cc(Br)nc(Br)c1.
What is the InChIKey of 2,4,6-tribromopyridine?
The InChIKey is WALXYTCBNHJWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Br3N/c6-3-1-4(7)9-5(8)2-3/h1-2H.
What are the key properties of 2,4,6-tribromopyridine?
2,4,6-tribromopyridine has a molecular weight of 315.79 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-tribromopyridine is sourced from PubChem (CID 13495919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).